3-Cyclohexyldodecane
| Internal ID | 461621b2-28ef-45dc-a717-d708bf2210f9 |
| Taxonomy | Hydrocarbons > Saturated hydrocarbons > Cycloalkanes |
| IUPAC Name | dodecan-3-ylcyclohexane |
| SMILES (Canonical) | CCCCCCCCCC(CC)C1CCCCC1 |
| SMILES (Isomeric) | CCCCCCCCCC(CC)C1CCCCC1 |
| InChI | InChI=1S/C18H36/c1-3-5-6-7-8-9-11-14-17(4-2)18-15-12-10-13-16-18/h17-18H,3-16H2,1-2H3 |
| InChI Key | ZDMYCNLANBQLOI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.50 g/mol |
| Exact Mass | 252.281701148 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 9.20 |
| Atomic LogP (AlogP) | 6.73 |
| H-Bond Acceptor | 0 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 10 |
| DTXSID601312361 |
| 13151-83-2 |
| RefChem:1049248 |
| DTXCID301742159 |
| 3-Cyclohexyldodecane |
| Dodecane, 3-cyclohexyl- |
| Cyclohexane, 1-ethyldecyl |
| dodecan-3-ylcyclohexane |
| 9-Cyclohexyl-Eicosane |
| (1-Ethyldecyl)cyclohexane # |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9947 | 99.47% |
| Caco-2 | + | 0.9116 | 91.16% |
| Blood Brain Barrier | + | 1.0000 | 100.00% |
| Human oral bioavailability | - | 0.5429 | 54.29% |
| Subcellular localzation | Lysosomes | 0.6135 | 61.35% |
| OATP2B1 inhibitior | - | 0.8484 | 84.84% |
| OATP1B1 inhibitior | + | 0.9372 | 93.72% |
| OATP1B3 inhibitior | + | 0.9416 | 94.16% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | - | 0.5826 | 58.26% |
| P-glycoprotein inhibitior | - | 0.9169 | 91.69% |
| P-glycoprotein substrate | - | 0.8024 | 80.24% |
| CYP3A4 substrate | - | 0.5821 | 58.21% |
| CYP2C9 substrate | - | 0.8153 | 81.53% |
| CYP2D6 substrate | - | 0.7243 | 72.43% |
| CYP3A4 inhibition | - | 0.9727 | 97.27% |
| CYP2C9 inhibition | - | 0.9255 | 92.55% |
| CYP2C19 inhibition | - | 0.9417 | 94.17% |
| CYP2D6 inhibition | - | 0.9190 | 91.90% |
| CYP1A2 inhibition | - | 0.6585 | 65.85% |
| CYP2C8 inhibition | - | 0.8762 | 87.62% |
| CYP inhibitory promiscuity | - | 0.7492 | 74.92% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7000 | 70.00% |
| Carcinogenicity (trinary) | Non-required | 0.5656 | 56.56% |
| Eye corrosion | + | 0.9869 | 98.69% |
| Eye irritation | + | 0.9477 | 94.77% |
| Skin irritation | + | 0.6381 | 63.81% |
| Skin corrosion | - | 0.9778 | 97.78% |
| Ames mutagenesis | - | 0.9437 | 94.37% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5334 | 53.34% |
| Micronuclear | - | 1.0000 | 100.00% |
| Hepatotoxicity | - | 0.5275 | 52.75% |
| skin sensitisation | + | 0.9521 | 95.21% |
| Respiratory toxicity | - | 0.6111 | 61.11% |
| Reproductive toxicity | - | 0.8139 | 81.39% |
| Mitochondrial toxicity | - | 0.7875 | 78.75% |
| Nephrotoxicity | + | 0.4546 | 45.46% |
| Acute Oral Toxicity (c) | III | 0.7427 | 74.27% |
| Estrogen receptor binding | - | 0.4845 | 48.45% |
| Androgen receptor binding | - | 0.6112 | 61.12% |
| Thyroid receptor binding | - | 0.5000 | 50.00% |
| Glucocorticoid receptor binding | - | 0.7177 | 71.77% |
| Aromatase binding | - | 0.7446 | 74.46% |
| PPAR gamma | - | 0.6908 | 69.08% |
| Honey bee toxicity | - | 0.9859 | 98.59% |
| Biodegradation | + | 0.6250 | 62.50% |
| Crustacea aquatic toxicity | + | 0.7169 | 71.69% |
| Fish aquatic toxicity | + | 0.9910 | 99.10% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 99.34% | 89.76% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 95.79% | 90.24% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.01% | 91.81% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.08% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.96% | 96.09% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 93.91% | 85.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.97% | 98.95% |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 92.69% | 98.57% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.16% | 93.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.88% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.67% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.32% | 97.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.33% | 92.86% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.24% | 97.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.56% | 95.50% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.05% | 99.18% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 86.66% | 95.27% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 86.34% | 96.00% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 84.67% | 96.67% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.67% | 92.50% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 84.66% | 99.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.53% | 92.88% |
| CHEMBL5331 | Q12866 | Proto-oncogene tyrosine-protein kinase MER | 84.00% | 91.67% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.62% | 98.33% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.44% | 92.08% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.43% | 95.17% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.78% | 95.58% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 82.76% | 94.55% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.59% | 82.69% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.57% | 97.47% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.29% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.05% | 100.00% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 81.97% | 95.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.78% | 93.31% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.13% | 90.71% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.68% | 97.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.28% | 97.79% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.18% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Angelica pubescens |
| Panax quinquefolius |