3-(4,5-Dihydroxy-2-methoxyphenyl)-7-hydroxychromen-4-one
| Internal ID | ccc81622-2862-41f3-b2e6-704ed607bf45 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
| IUPAC Name | 3-(4,5-dihydroxy-2-methoxyphenyl)-7-hydroxychromen-4-one |
| SMILES (Canonical) | COC1=CC(=C(C=C1C2=COC3=C(C2=O)C=CC(=C3)O)O)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1C2=COC3=C(C2=O)C=CC(=C3)O)O)O |
| InChI | InChI=1S/C16H12O6/c1-21-14-6-13(19)12(18)5-10(14)11-7-22-15-4-8(17)2-3-9(15)16(11)20/h2-7,17-19H,1H3 |
| InChI Key | SNYJAORFYCDMDF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.59% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.62% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.03% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.83% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.55% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.96% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.65% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.88% | 85.14% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.79% | 89.62% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 85.75% | 98.21% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.28% | 99.23% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.00% | 90.20% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.95% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 83.33% | 90.71% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.70% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia nitidula |
| PubChem | 91256347 |
| LOTUS | LTS0203063 |
| wikiData | Q105256754 |