3-(4-Methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one
| Internal ID | 4cdf8526-168d-4914-9aac-4ebc5f719ee4 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2O)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2O)O)O |
| InChI | InChI=1S/C16H16O5/c1-21-12-5-2-10(3-6-12)4-7-13(18)16-14(19)8-11(17)9-15(16)20/h2-3,5-6,8-9,17,19-20H,4,7H2,1H3 |
| InChI Key | YQNPVOBVGNGYHD-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 3.00 |
| 3-(4-Methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| 4-METHOXY-2',4',6'-TRIHYDROXYDIHYDROCHALCONE |
| 2',4',6'-Trihydroxy-4-methoxydihydrochalcone |
| CHEMBL4101262 |
| Isosakuranetin dihydrochalcone |
| Dihydrosakuranetin |
| O-methyl phloretin |
| EINECS 278-386-7 |
| SCHEMBL457127 |
| DTXSID90997516 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.96% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.06% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.02% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.01% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.10% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.62% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.90% | 96.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.30% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.24% | 94.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.59% | 95.50% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.80% | 90.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.11% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.09% | 99.15% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.59% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Iryanthera laevis |
| Iryanthera sagotiana |
| Piper sarmentosum |
| PubChem | 3086055 |
| LOTUS | LTS0083345 |
| wikiData | Q82989664 |