3-(4-Hydroxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-2-propenamide
Internal ID | f98348fd-9930-44eb-8ad8-d52493b7a1a5 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | 3-(4-hydroxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C=CC3=CC=C(C=C3)O |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C=CC3=CC=C(C=C3)O |
InChI | InChI=1S/C19H18N2O2/c22-16-8-5-14(6-9-16)7-10-19(23)20-12-11-15-13-21-18-4-2-1-3-17(15)18/h1-10,13,21-22H,11-12H2,(H,20,23) |
InChI Key | CDMGLLBADMBULG-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H18N2O2 |
Molecular Weight | 306.40 g/mol |
Exact Mass | 306.136827821 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 3.50 |
MFCD30537121 |
SY047834 |
3-(4-Hydroxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-2-propenamide |
53905-12-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 95.36% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.82% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 94.75% | 98.95% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 93.57% | 89.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.63% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.82% | 89.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.48% | 83.10% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.87% | 93.99% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 89.38% | 98.59% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.31% | 89.67% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.64% | 96.67% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.28% | 89.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.80% | 96.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.89% | 91.71% |
CHEMBL2535 | P11166 | Glucose transporter | 85.32% | 98.75% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.91% | 88.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.70% | 96.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.35% | 96.39% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.11% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.76% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.76% | 89.62% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.84% | 94.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.59% | 94.73% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.13% | 89.44% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.06% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carthamus tinctorius |
Cinnamosma madagascariensis |
Zea mays |
PubChem | 66803733 |
LOTUS | LTS0106364 |
wikiData | Q104954602 |