3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propanamide
| Internal ID | 5dc631f8-655c-470a-ad2c-b746f459fd39 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propanamide |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)CCC(=O)NCCC2=CC=C(C=C2)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)CCC(=O)NCCC2=CC=C(C=C2)O |
| InChI | InChI=1S/C19H23NO5/c1-24-16-11-14(12-17(25-2)19(16)23)5-8-18(22)20-10-9-13-3-6-15(21)7-4-13/h3-4,6-7,11-12,21,23H,5,8-10H2,1-2H3,(H,20,22) |
| InChI Key | VXZDYKWGUZLDTR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 88.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propanamide](https://plantaedb.com/storage/docs/compounds/2023/11/3-4-hydroxy-35-dimethoxyphenyl-n-2-4-hydroxyphenylethylpropanamide.jpg "2D Structure of 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propanamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.06% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.82% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.59% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.51% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.48% | 90.20% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 89.65% | 89.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.35% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.93% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.69% | 90.00% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 88.05% | 97.03% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.95% | 96.67% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 87.35% | 94.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.03% | 97.21% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.93% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.89% | 94.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.81% | 95.89% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 81.31% | 95.34% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.05% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annona squamosa |
| PubChem | 12096981 |
| LOTUS | LTS0097597 |
| wikiData | Q105298846 |