3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2,3-dihydropyrano[3,2-g][1,4]benzodioxin-9-one
Internal ID | 9e043802-5faa-4fc2-8c37-306874027da3 |
Taxonomy | Organoheterocyclic compounds > Benzodioxanes > Phenylbenzodioxanes > Phenylbenzo-1,4-dioxanes |
IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-2,3-dihydropyrano[3,2-g][1,4]benzodioxin-9-one |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(OC3=C(O2)C=C4C(=C3)C(=O)C=CO4)CO |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2C(OC3=C(O2)C=C4C(=C3)C(=O)C=CO4)CO |
InChI | InChI=1S/C20H18O8/c1-24-16-5-10(6-17(25-2)19(16)23)20-18(9-21)27-14-7-11-12(22)3-4-26-13(11)8-15(14)28-20/h3-8,18,20-21,23H,9H2,1-2H3 |
InChI Key | KIALIUIIYHDOKW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O8 |
Molecular Weight | 386.40 g/mol |
Exact Mass | 386.10016753 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.38% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.08% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.35% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.67% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 91.41% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.17% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.13% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.75% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.25% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.10% | 91.49% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.98% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.89% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.40% | 96.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.96% | 94.03% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.22% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daphne mezereum |
PubChem | 162978720 |
LOTUS | LTS0170277 |
wikiData | Q105141423 |