3-[4-(1,3-Dihydroxypropan-2-yloxy)-3-methoxyphenyl]prop-2-enal
Internal ID | 5d5146e1-9e5a-477e-8033-3897da6e1484 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamaldehydes |
IUPAC Name | 3-[4-(1,3-dihydroxypropan-2-yloxy)-3-methoxyphenyl]prop-2-enal |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC=O)OC(CO)CO |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC=O)OC(CO)CO |
InChI | InChI=1S/C13H16O5/c1-17-13-7-10(3-2-6-14)4-5-12(13)18-11(8-15)9-16/h2-7,11,15-16H,8-9H2,1H3 |
InChI Key | WBHVJYRXIMGFCQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H16O5 |
Molecular Weight | 252.26 g/mol |
Exact Mass | 252.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of 3-[4-(1,3-Dihydroxypropan-2-yloxy)-3-methoxyphenyl]prop-2-enal 2D Structure of 3-[4-(1,3-Dihydroxypropan-2-yloxy)-3-methoxyphenyl]prop-2-enal](https://plantaedb.com/storage/docs/compounds/2023/11/3-4-13-dihydroxypropan-2-yloxy-3-methoxyphenylprop-2-enal.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.57% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.67% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.39% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.44% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.03% | 90.20% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.87% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 84.74% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.12% | 90.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.15% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.64% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 80.71% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.06% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tanacetum parthenium |
PubChem | 162920423 |
LOTUS | LTS0124815 |
wikiData | Q105300762 |