3-(2,4-Dihydroxyphenyl)-1-(2,2-dimethylchromen-6-yl)prop-2-en-1-one
| Internal ID | afe9aac2-1d00-4e90-baa5-22e3f2428841 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > Retrochalcones |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-1-(2,2-dimethylchromen-6-yl)prop-2-en-1-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC(=C2)C(=O)C=CC3=C(C=C(C=C3)O)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC(=C2)C(=O)C=CC3=C(C=C(C=C3)O)O)C |
| InChI | InChI=1S/C20H18O4/c1-20(2)10-9-15-11-14(5-8-19(15)24-20)17(22)7-4-13-3-6-16(21)12-18(13)23/h3-12,21,23H,1-2H3 |
| InChI Key | CKEDEFCTCYZPGM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.68% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.04% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 94.39% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.82% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.44% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.90% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.69% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.48% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.84% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.38% | 94.73% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.03% | 89.67% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.81% | 93.10% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.97% | 80.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.79% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mundulea sericea |
| PubChem | 85133633 |
| LOTUS | LTS0113713 |
| wikiData | Q104962205 |