3-(2-Methylpropanoyloxy)-8-(3-methylbutanoyloxy)-9,10-epoxy-p-mentha-1,3,5-triene
Internal ID | 74cd9b13-6b60-47f9-aa3b-e51d0fd8673d |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | [2-[4-methyl-2-(2-methylpropanoyloxy)phenyl]oxiran-2-yl]methyl 3-methylbutanoate |
SMILES (Canonical) | CC1=CC(=C(C=C1)C2(CO2)COC(=O)CC(C)C)OC(=O)C(C)C |
SMILES (Isomeric) | CC1=CC(=C(C=C1)C2(CO2)COC(=O)CC(C)C)OC(=O)C(C)C |
InChI | InChI=1S/C19H26O5/c1-12(2)8-17(20)22-10-19(11-23-19)15-7-6-14(5)9-16(15)24-18(21)13(3)4/h6-7,9,12-13H,8,10-11H2,1-5H3 |
InChI Key | QVGMYLIEMRLBGN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O5 |
Molecular Weight | 334.40 g/mol |
Exact Mass | 334.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 3.50 |
CHEMBL5209064 |
CHEBI:173268 |
[2-[4-methyl-2-(2-methylpropanoyloxy)phenyl]oxiran-2-yl]methyl 3-methylbutanoate |
![2D Structure of 3-(2-Methylpropanoyloxy)-8-(3-methylbutanoyloxy)-9,10-epoxy-p-mentha-1,3,5-triene 2D Structure of 3-(2-Methylpropanoyloxy)-8-(3-methylbutanoyloxy)-9,10-epoxy-p-mentha-1,3,5-triene](https://plantaedb.com/storage/docs/compounds/2023/11/3-2-methylpropanoyloxy-8-3-methylbutanoyloxy-910-epoxy-p-mentha-135-triene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.81% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.10% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.95% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.34% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.28% | 97.21% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.23% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.33% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.90% | 94.45% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.40% | 94.80% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.72% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.00% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.45% | 89.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.29% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.36% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.78% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 81.59% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ageratina anisochroma |
Madia sativa |
PubChem | 13819150 |
LOTUS | LTS0078463 |
wikiData | Q105228655 |