3-[2-[2-(3,4-Dihydroxyphenyl)ethoxy]-2-oxoethyl]-4-formyl-2-(hydroxymethylidene)hex-4-enoic acid
| Internal ID | d094dca8-7da8-4ac1-bfe7-7a753e0f027d |
| Taxonomy | Benzenoids > Phenols > Tyrosols and derivatives |
| IUPAC Name | 3-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-4-formyl-2-(hydroxymethylidene)hex-4-enoic acid |
| SMILES (Canonical) | CC=C(C=O)C(CC(=O)OCCC1=CC(=C(C=C1)O)O)C(=CO)C(=O)O |
| SMILES (Isomeric) | CC=C(C=O)C(CC(=O)OCCC1=CC(=C(C=C1)O)O)C(=CO)C(=O)O |
| InChI | InChI=1S/C18H20O8/c1-2-12(9-19)13(14(10-20)18(24)25)8-17(23)26-6-5-11-3-4-15(21)16(22)7-11/h2-4,7,9-10,13,20-22H,5-6,8H2,1H3,(H,24,25) |
| InChI Key | ZHJLJRTZUXRSLQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.11581759 g/mol |
| Topological Polar Surface Area (TPSA) | 141.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of 3-[2-[2-(3,4-Dihydroxyphenyl)ethoxy]-2-oxoethyl]-4-formyl-2-(hydroxymethylidene)hex-4-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3-2-2-34-dihydroxyphenylethoxy-2-oxoethyl-4-formyl-2-hydroxymethylidenehex-4-enoic-acid.jpg "2D Structure of 3-[2-[2-(3,4-Dihydroxyphenyl)ethoxy]-2-oxoethyl]-4-formyl-2-(hydroxymethylidene)hex-4-enoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.41% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.13% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.63% | 94.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.58% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.46% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.45% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.76% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.34% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.83% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.27% | 99.15% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.80% | 86.92% |
| CHEMBL3194 | P02766 | Transthyretin | 83.58% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.70% | 90.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.10% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.84% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Olea europaea |
| PubChem | 162981824 |
| LOTUS | LTS0051525 |
| wikiData | Q105375785 |