(2S)-5-hydroxy-2-(2-hydroxy-4-methoxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one
Internal ID | 7e99061f-8243-49df-8569-7c1260ab0d4e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | (2S)-5-hydroxy-2-(2-hydroxy-4-methoxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC)O)O |
SMILES (Isomeric) | COC1=CC(=C(C=C1)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)OC)O)O |
InChI | InChI=1S/C17H16O6/c1-21-9-3-4-11(12(18)5-9)15-8-14(20)17-13(19)6-10(22-2)7-16(17)23-15/h3-7,15,18-19H,8H2,1-2H3/t15-/m0/s1 |
InChI Key | SNKAPDDRKJEOFE-HNNXBMFYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H16O6 |
Molecular Weight | 316.30 g/mol |
Exact Mass | 316.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 2.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.19% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.55% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.95% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.40% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.61% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.58% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.03% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.39% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.81% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.81% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.69% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.42% | 99.17% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.26% | 91.07% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.23% | 96.12% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.78% | 93.40% |
CHEMBL2535 | P11166 | Glucose transporter | 83.74% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.12% | 92.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.41% | 93.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.71% | 89.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.38% | 91.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.38% | 90.71% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.51% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus heterophyllus |
PubChem | 101930089 |
LOTUS | LTS0166015 |
wikiData | Q105256509 |