(2S)-2,6-dimethyl-2-(4-methylpent-3-enyl)pyrano[3,2-c]quinolin-5-one
Internal ID | 3504f6a1-820f-40f7-9ef7-ae207ce363ed |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Pyranoquinolines |
IUPAC Name | (2S)-2,6-dimethyl-2-(4-methylpent-3-enyl)pyrano[3,2-c]quinolin-5-one |
SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C3=CC=CC=C3N(C2=O)C)C)C |
SMILES (Isomeric) | CC(=CCC[C@]1(C=CC2=C(O1)C3=CC=CC=C3N(C2=O)C)C)C |
InChI | InChI=1S/C20H23NO2/c1-14(2)8-7-12-20(3)13-11-16-18(23-20)15-9-5-6-10-17(15)21(4)19(16)22/h5-6,8-11,13H,7,12H2,1-4H3/t20-/m0/s1 |
InChI Key | VMCDFWKTDCXEJZ-FQEVSTJZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H23NO2 |
Molecular Weight | 309.40 g/mol |
Exact Mass | 309.172878976 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 4.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.37% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.74% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.34% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.80% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.63% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.36% | 85.14% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 92.52% | 98.59% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.13% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.45% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.96% | 94.75% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.47% | 85.94% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.73% | 99.23% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.97% | 90.08% |
CHEMBL240 | Q12809 | HERG | 80.92% | 89.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum bungeanum |
Zanthoxylum simulans |
PubChem | 162884484 |
LOTUS | LTS0202727 |
wikiData | Q105288891 |