(2S)-2,6-dimethyl-1-oxo-2,3-dihydroindene-4-carboxylic acid
| Internal ID | 8a6aad6d-708f-41b4-8e45-1d3c846f89be |
| Taxonomy | Benzenoids > Indanes > Indanones |
| IUPAC Name | (2S)-2,6-dimethyl-1-oxo-2,3-dihydroindene-4-carboxylic acid |
| SMILES (Canonical) | CC1CC2=C(C1=O)C=C(C=C2C(=O)O)C |
| SMILES (Isomeric) | C[C@H]1CC2=C(C1=O)C=C(C=C2C(=O)O)C |
| InChI | InChI=1S/C12H12O3/c1-6-3-9-8(5-7(2)11(9)13)10(4-6)12(14)15/h3-4,7H,5H2,1-2H3,(H,14,15)/t7-/m0/s1 |
| InChI Key | ASNYCVAGBSOWNP-ZETCQYMHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.078644241 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.37% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.89% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.83% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.30% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.62% | 99.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.70% | 93.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.96% | 93.03% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.77% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.66% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.67% | 98.75% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 81.17% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.56% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.37% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Croton steenkampianus |
| PubChem | 162916216 |
| LOTUS | LTS0120897 |
| wikiData | Q104917959 |