(2S)-2-[(2R)-1,2-dihydroxypropan-2-yl]-2,3-dihydro-1-benzofuran-5-carbaldehyde
| Internal ID | c84749a2-3aad-428e-9cca-fbefa6a4b78f |
| Taxonomy | Organoheterocyclic compounds > Coumarans |
| IUPAC Name | (2S)-2-[(2R)-1,2-dihydroxypropan-2-yl]-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| SMILES (Canonical) | CC(CO)(C1CC2=C(O1)C=CC(=C2)C=O)O |
| SMILES (Isomeric) | C[C@@](CO)([C@@H]1CC2=C(O1)C=CC(=C2)C=O)O |
| InChI | InChI=1S/C12H14O4/c1-12(15,7-14)11-5-9-4-8(6-13)2-3-10(9)16-11/h2-4,6,11,14-15H,5,7H2,1H3/t11-,12+/m0/s1 |
| InChI Key | NFOLCIKUKLTTDV-NWDGAFQWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
![2D Structure of (2S)-2-[(2R)-1,2-dihydroxypropan-2-yl]-2,3-dihydro-1-benzofuran-5-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/2s-2-2r-12-dihydroxypropan-2-yl-23-dihydro-1-benzofuran-5-carbaldehyde.jpg "2D Structure of (2S)-2-[(2R)-1,2-dihydroxypropan-2-yl]-2,3-dihydro-1-benzofuran-5-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.51% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.75% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.86% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.24% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.55% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.98% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.50% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.71% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.56% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.09% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.43% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.44% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hibiscus rosa-sinensis |
| PubChem | 92449342 |
| LOTUS | LTS0063720 |
| wikiData | Q105349482 |