(2R,3R,4S,5S,6R)-2-(7-hydroxy-4-methoxyphenanthren-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | a88221d0-4ce8-43bc-aa5c-1d7305eaa01d |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-(7-hydroxy-4-methoxyphenanthren-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C2C(=CC(=C1)OC3C(C(C(C(O3)CO)O)O)O)C=CC4=C2C=CC(=C4)O |
SMILES (Isomeric) | COC1=C2C(=CC(=C1)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C=CC4=C2C=CC(=C4)O |
InChI | InChI=1S/C21H22O8/c1-27-15-8-13(28-21-20(26)19(25)18(24)16(9-22)29-21)7-11-3-2-10-6-12(23)4-5-14(10)17(11)15/h2-8,16,18-26H,9H2,1H3/t16-,18-,19+,20-,21+/m1/s1 |
InChI Key | WMZBYVNQADXHMK-RQXATKFSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O8 |
Molecular Weight | 402.40 g/mol |
Exact Mass | 402.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.33% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.76% | 94.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.80% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.65% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.28% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.96% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.61% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.48% | 92.94% |
CHEMBL220 | P22303 | Acetylcholinesterase | 84.28% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.99% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.11% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.01% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.67% | 92.62% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.41% | 86.92% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 82.20% | 98.35% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.82% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.66% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.57% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bletilla striata |
PubChem | 162931425 |
LOTUS | LTS0072024 |
wikiData | Q105308926 |