(2R,3R)-2,3-Dihydro-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
Internal ID | bbb8712d-5ce6-409f-b312-9cde0ade518f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | (2R,3R)-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC(C(C2=O)O)C3=CC(=C(C=C3)O)OC)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)O[C@@H]([C@H](C2=O)O)C3=CC(=C(C=C3)O)OC)O |
InChI | InChI=1S/C17H16O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,16-19,21H,1-2H3/t16-,17+/m0/s1 |
InChI Key | DQZRHRLTSJNVBC-DLBZAZTESA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H16O7 |
Molecular Weight | 332.30 g/mol |
Exact Mass | 332.08960285 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 2.10 |
(2R,3R)-2,3-Dihydro-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
37971-67-8 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.14% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.91% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.52% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.93% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.63% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.54% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.31% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.12% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.32% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 88.18% | 98.75% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.49% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.47% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 84.80% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.71% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.28% | 94.73% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.83% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.50% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia campestris |
Artemisia campestris subsp. variabilis |
Artemisia dracunculus |
Eupatorium capillifolium |
Grindelia hirsutula |
Picea neoveitchii |
PubChem | 132607006 |
LOTUS | LTS0127734 |
wikiData | Q104987302 |