(2R)-8,10-dihydroxy-2,5-dimethyl-2,3-dihydrobenzo[h]chromen-4-one
| Internal ID | 758c5158-c7ce-4cbf-8706-a1e0c5cdac6d |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | (2R)-8,10-dihydroxy-2,5-dimethyl-2,3-dihydrobenzo[h]chromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H14O4/c1-7-3-9-5-10(16)6-12(18)14(9)15-13(7)11(17)4-8(2)19-15/h3,5-6,8,16,18H,4H2,1-2H3/t8-/m1/s1 |
| InChI Key | LFEVSCCUJFVIFA-MRVPVSSYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of (2R)-8,10-dihydroxy-2,5-dimethyl-2,3-dihydrobenzo[h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2r-810-dihydroxy-25-dimethyl-23-dihydrobenzohchromen-4-one.jpg "2D Structure of (2R)-8,10-dihydroxy-2,5-dimethyl-2,3-dihydrobenzo[h]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.43% | 98.95% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.00% | 96.12% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.65% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.48% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.26% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.36% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.28% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.98% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.76% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.64% | 90.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.94% | 85.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.82% | 90.71% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.41% | 86.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.29% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.92% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.95% | 94.80% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.53% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.38% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eleutherine bulbosa |
| PubChem | 102473740 |
| LOTUS | LTS0072223 |
| wikiData | Q105150986 |