(2R)-5,10-dihydroxy-2,11-dimethyl-2-(4-methylpent-3-enyl)pyrano[3,2-b]acridin-6-one
| Internal ID | 07cdf77e-c3b4-44d8-8a57-9ee489e7711a |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | (2R)-5,10-dihydroxy-2,11-dimethyl-2-(4-methylpent-3-enyl)pyrano[3,2-b]acridin-6-one |
| SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C4=C(N3C)C(=CC=C4)O)C)C |
| SMILES (Isomeric) | CC(=CCC[C@@]1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C4=C(N3C)C(=CC=C4)O)C)C |
| InChI | InChI=1S/C24H25NO4/c1-14(2)7-6-11-24(3)12-10-15-19(29-24)13-17-20(22(15)27)23(28)16-8-5-9-18(26)21(16)25(17)4/h5,7-10,12-13,26-27H,6,11H2,1-4H3/t24-/m1/s1 |
| InChI Key | LYQTWUUUBGUIDB-XMMPIXPASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of (2R)-5,10-dihydroxy-2,11-dimethyl-2-(4-methylpent-3-enyl)pyrano[3,2-b]acridin-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/2r-510-dihydroxy-211-dimethyl-2-4-methylpent-3-enylpyrano32-bacridin-6-one.jpg "2D Structure of (2R)-5,10-dihydroxy-2,11-dimethyl-2-(4-methylpent-3-enyl)pyrano[3,2-b]acridin-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.23% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.52% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.38% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.31% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.04% | 94.45% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 95.98% | 95.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.59% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.49% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.80% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.60% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.18% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.71% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.16% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.44% | 91.49% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.57% | 83.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.09% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.08% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.95% | 92.62% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.50% | 96.37% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis parviflora |
| PubChem | 162904490 |
| LOTUS | LTS0128366 |
| wikiData | Q105159497 |