(2R)-2-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]-7-hydroxy-6-methylhept-5-enoic acid
| Internal ID | 11d53684-3e9c-4b34-b259-d6b72d298d6b |
| Taxonomy | Organic acids and derivatives > Hydroxy acids and derivatives > Medium-chain hydroxy acids and derivatives |
| IUPAC Name | (2R)-2-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]-7-hydroxy-6-methylhept-5-enoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H19N3O3/c1-7(6-15)3-2-4-8(10(16)17)9-5-13-11(12)14-9/h3,8-9,15H,2,4-6H2,1H3,(H,16,17)(H3,12,13,14)/t8-,9+/m1/s1 |
| InChI Key | MKVOYTACJBMDBA-BDAKNGLRSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14264148 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | -0.70 |
| There are no found synonyms. |
![2D Structure of (2R)-2-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]-7-hydroxy-6-methylhept-5-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2r-2-5r-2-amino-45-dihydro-1h-imidazol-5-yl-7-hydroxy-6-methylhept-5-enoic-acid.jpg "2D Structure of (2R)-2-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]-7-hydroxy-6-methylhept-5-enoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.83% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.83% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.65% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.13% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.19% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.02% | 91.19% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 81.46% | 95.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.18% | 93.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.57% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.44% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plumbago zeylanica |
| PubChem | 163094398 |
| LOTUS | LTS0043247 |
| wikiData | Q105166244 |