(2R)-2-(3-hydroxy-5-methoxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromen-7-ol
Internal ID | 4e1bc53b-a413-4403-a8c0-c092b0c30967 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans |
IUPAC Name | (2R)-2-(3-hydroxy-5-methoxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromen-7-ol |
SMILES (Canonical) | CC(=CCC1=C2C(=C(C=C1O)OC)CCC(O2)C3=CC(=CC(=C3)OC)O)C |
SMILES (Isomeric) | CC(=CCC1=C2C(=C(C=C1O)OC)CC[C@@H](O2)C3=CC(=CC(=C3)OC)O)C |
InChI | InChI=1S/C22H26O5/c1-13(2)5-6-17-19(24)12-21(26-4)18-7-8-20(27-22(17)18)14-9-15(23)11-16(10-14)25-3/h5,9-12,20,23-24H,6-8H2,1-4H3/t20-/m1/s1 |
InChI Key | OKXSQEFLSCOCRF-HXUWFJFHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H26O5 |
Molecular Weight | 370.40 g/mol |
Exact Mass | 370.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.87% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.13% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.09% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.38% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.87% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.29% | 95.89% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.51% | 96.12% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.40% | 91.49% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.02% | 92.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.93% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.26% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.96% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.48% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.21% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.48% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.31% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 82.16% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.24% | 90.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.09% | 92.68% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.57% | 99.18% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.54% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyperus conglomeratus |
PubChem | 163082161 |
LOTUS | LTS0050435 |
wikiData | Q105193819 |