(2R)-1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol
| Internal ID | d70ab583-091b-48ea-8af8-50a9c1dd96d9 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | (2R)-1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol |
| SMILES (Canonical) | CC(=C)C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O |
| SMILES (Isomeric) | CC(=C)[C@H](COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O |
| InChI | InChI=1S/C18H19NO5/c1-10(2)13(20)9-24-14-6-5-11-15(17(14)22-4)19-18-12(7-8-23-18)16(11)21-3/h5-8,13,20H,1,9H2,2-4H3/t13-/m0/s1 |
| InChI Key | LNJTUUHDKCPQAA-ZDUSSCGKSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.12632271 g/mol |
| Topological Polar Surface Area (TPSA) | 74.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of (2R)-1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2r-1-48-dimethoxyfuro23-bquinolin-7-yloxy-3-methylbut-3-en-2-ol.jpg "2D Structure of (2R)-1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.47% | 83.82% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.95% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.79% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.10% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.19% | 94.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 89.86% | 95.12% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.40% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.10% | 99.17% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.60% | 94.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.24% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.66% | 94.73% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.41% | 92.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.34% | 91.11% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.29% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.88% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.33% | 94.45% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.53% | 92.98% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.50% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum acutifolium |
| Haplophyllum ferganicum |
| Haplophyllum obtusifolium |
| PubChem | 92443142 |
| LOTUS | LTS0093844 |
| wikiData | Q105154355 |