(2S,3R,4R,5R,6S)-2-[(2R,3S,4R,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1R,2S,3R,4R,5'R,6R,7S,8R,9S,12S,13S,16S,18S)-3-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
| Internal ID | 44656e7e-8c18-45a0-86a2-50b894e1cd0a |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4R,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1R,2S,3R,4R,5'R,6R,7S,8R,9S,12S,13S,16S,18S)-3-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1CCC2(C(C3C(O2)C(C4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)OC2C(C(C(C(O2)C)O)O)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)C)C)O)C)OC1 |
| SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)[C@@H]([C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)C)C)O)C)OC1 |
| InChI | InChI=1S/C57H94O28/c1-20-8-13-57(74-19-20)21(2)31-47(85-57)36(65)32-25-7-6-23-14-24(9-11-55(23,4)26(25)10-12-56(31,32)5)76-51-43(72)39(68)46(30(18-61)79-51)82-54-49(84-52-42(71)38(67)34(63)27(15-58)77-52)48(35(64)28(16-59)78-54)83-53-44(73)40(69)45(29(17-60)80-53)81-50-41(70)37(66)33(62)22(3)75-50/h20-54,58-73H,6-19H2,1-5H3/t20-,21+,22+,23+,24+,25-,26+,27-,28-,29-,30-,31+,32-,33+,34-,35-,36-,37-,38+,39-,40-,41-,42-,43-,44-,45-,46+,47-,48+,49-,50+,51-,52+,53+,54+,55+,56-,57-/m1/s1 |
| InChI Key | YYHMOKYJFKQIPD-OCDQAIFTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C57H94O28 |
| Molecular Weight | 1227.30 g/mol |
| Exact Mass | 1226.59316234 g/mol |
| Topological Polar Surface Area (TPSA) | 434.00 Ų |
| XlogP | -3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.40% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.35% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.76% | 97.09% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.04% | 98.10% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.96% | 96.61% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.37% | 89.05% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.33% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 90.66% | 97.93% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.89% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.17% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.11% | 95.93% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.71% | 97.31% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.02% | 91.49% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.94% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.79% | 92.50% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.20% | 97.86% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.96% | 89.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.77% | 95.58% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.38% | 92.94% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.20% | 91.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.01% | 86.33% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.01% | 92.86% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.39% | 96.21% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.22% | 97.50% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.10% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.84% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.75% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.62% | 94.45% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.08% | 98.99% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.84% | 95.83% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.69% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Camassia leichtlinii |
| PubChem | 10653940 |
| LOTUS | LTS0125796 |
| wikiData | Q105368639 |