methyl (1S,4R,4aR,5aS,6R,10aS)-1-methyl-2'-oxospiro[1,3,4,4a,5,5a,7,8,10,10a-decahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate
Internal ID | d4ba3700-b6ae-43e4-912d-c7ef30e3a9a6 |
Taxonomy | Alkaloids and derivatives > Yohimbine alkaloids |
IUPAC Name | methyl (1S,4R,4aR,5aS,6R,10aS)-1-methyl-2'-oxospiro[1,3,4,4a,5,5a,7,8,10,10a-decahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate |
SMILES (Canonical) | CC1C2CN3CCC4(C3CC2C(CO1)C(=O)OC)C5=CC=CC=C5NC4=O |
SMILES (Isomeric) | C[C@H]1[C@@H]2CN3CC[C@]4([C@@H]3C[C@H]2[C@H](CO1)C(=O)OC)C5=CC=CC=C5NC4=O |
InChI | InChI=1S/C21H26N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,12-15,18H,7-11H2,1-2H3,(H,22,25)/t12-,13+,14-,15-,18-,21+/m0/s1 |
InChI Key | BYHYWWSHNOLDME-YUAATXHZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H26N2O4 |
Molecular Weight | 370.40 g/mol |
Exact Mass | 370.18925731 g/mol |
Topological Polar Surface Area (TPSA) | 67.90 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of methyl (1S,4R,4aR,5aS,6R,10aS)-1-methyl-2'-oxospiro[1,3,4,4a,5,5a,7,8,10,10a-decahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate 2D Structure of methyl (1S,4R,4aR,5aS,6R,10aS)-1-methyl-2'-oxospiro[1,3,4,4a,5,5a,7,8,10,10a-decahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/2ed9e2b0-8618-11ee-bac3-e3dde319b440.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.27% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.92% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.11% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.18% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.09% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 87.49% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.49% | 85.14% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.17% | 94.08% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.01% | 93.03% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.76% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.06% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.33% | 82.69% |
CHEMBL5028 | O14672 | ADAM10 | 83.80% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.57% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.28% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mitragyna hirsuta |
PubChem | 163040760 |
LOTUS | LTS0132401 |
wikiData | Q104949339 |