(2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-6-[3-methoxy-4-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 07ba7a04-4d4d-4bbb-bb9b-669e4977a99b |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-6-[3-methoxy-4-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1C(C(C(C(O1)OC2=C(C=C(C=C2)C3C4COC(C4CO3)C5=CC(=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)OC)OC)O)O)O |
SMILES (Isomeric) | CO[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=C(C=C(C=C2)[C@@H]3[C@H]4CO[C@@H]([C@H]4CO3)C5=CC(=C(C=C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)OC)OC)O)O)O |
InChI | InChI=1S/C32H42O16/c1-40-19-8-13(4-6-17(19)45-31-26(38)23(35)22(34)21(10-33)47-31)28-15-11-44-29(16(15)12-43-28)14-5-7-18(20(9-14)41-2)46-32-27(39)24(36)25(37)30(42-3)48-32/h4-9,15-16,21-39H,10-12H2,1-3H3/t15-,16-,21+,22+,23-,24-,25-,26+,27+,28+,29+,30-,31+,32+/m0/s1 |
InChI Key | DPJGADMLARFYCD-JZCDLKBQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O16 |
Molecular Weight | 682.70 g/mol |
Exact Mass | 682.24728525 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-6-[3-methoxy-4-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-6-[3-methoxy-4-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2ebc66a0-84b5-11ee-b33d-b909adb8b993.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.93% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.14% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.18% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.20% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 90.05% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.57% | 89.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.68% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.50% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.32% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.31% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.07% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.82% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.75% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.32% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.80% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.70% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.66% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.07% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cratoxylum cochinchinense |
Eucommia ulmoides |
PubChem | 163008974 |
LOTUS | LTS0065575 |
wikiData | Q105145948 |