(2E,8E)-Piperamide-C9:2
Internal ID | 9eb4b4e3-7331-4292-b973-aa20f2e5b942 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | (2E,8Z)-9-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylnona-2,8-dien-1-one |
SMILES (Canonical) | C1CCN(C1)C(=O)C=CCCCCC=CC2=CC3=C(C=C2)OCO3 |
SMILES (Isomeric) | C1CCN(C1)C(=O)/C=C/CCCC/C=C\C2=CC3=C(C=C2)OCO3 |
InChI | InChI=1S/C20H25NO3/c22-20(21-13-7-8-14-21)10-6-4-2-1-3-5-9-17-11-12-18-19(15-17)24-16-23-18/h5-6,9-12,15H,1-4,7-8,13-14,16H2/b9-5-,10-6+ |
InChI Key | BYKNKNBUHGFXQF-VTBWALSUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H25NO3 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.18344366 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 4.40 |
Piperamide-C9:2 (2E,8E) |
CHEBI:169098 |
1-[9-(3,4-Methylenedioxyphenyl)-2,8-nonadienoyl]pyrrolidine |
9-(3,4-Methylenedioxyphenyl)-2,8-nonadienoic acid pyrrolidide |
(2E,8Z)-9-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylnona-2,8-dien-1-one |
1-[9-(1,3-Benzodioxol-5-yl)-1-oxo-2,8-nonadienyl]pyrrolidine, 9CI |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.09% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.92% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.25% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.93% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.59% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.90% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.83% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.60% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.34% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.30% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.22% | 91.71% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.79% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.26% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.95% | 90.71% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.41% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper mullesua |
Piper sarmentosum |
PubChem | 131752411 |
LOTUS | LTS0086779 |
wikiData | Q104949452 |