(2E,6E,8E)-10-hydroxy-N-(2-hydroxy-2-methylpropyl)-5-oxoundeca-2,6,8-trienamide
| Internal ID | 5771f15c-d4a4-46fb-a0f2-8c7a8516ca0f |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,6E,8E)-10-hydroxy-N-(2-hydroxy-2-methylpropyl)-5-oxoundeca-2,6,8-trienamide |
| SMILES (Canonical) | CC(C=CC=CC(=O)CC=CC(=O)NCC(C)(C)O)O |
| SMILES (Isomeric) | CC(/C=C/C=C/C(=O)C/C=C/C(=O)NCC(C)(C)O)O |
| InChI | InChI=1S/C15H23NO4/c1-12(17)7-4-5-8-13(18)9-6-10-14(19)16-11-15(2,3)20/h4-8,10,12,17,20H,9,11H2,1-3H3,(H,16,19)/b7-4+,8-5+,10-6+ |
| InChI Key | SYVYFQYWWPNZDM-CFTJBZHISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 96.86% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.02% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.37% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.30% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.64% | 91.11% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.69% | 95.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.53% | 97.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.61% | 96.47% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.30% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.86% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.69% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.48% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.82% | 85.14% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 81.26% | 80.00% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 81.02% | 98.57% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 80.64% | 98.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.32% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum bungeanum |
| PubChem | 127025457 |
| LOTUS | LTS0165288 |
| wikiData | Q105263815 |