[(2E,6E)-2,6-dimethyl-9-[(2S)-2-methyl-5-oxopyrano[3,2-c]chromen-2-yl]nona-2,6-dienyl] acetate
Internal ID | 8b0d8898-af77-473a-8f80-98240946afd5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(2E,6E)-2,6-dimethyl-9-[(2S)-2-methyl-5-oxopyrano[3,2-c]chromen-2-yl]nona-2,6-dienyl] acetate |
SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C3=CC=CC=C3OC2=O)C)CCC=C(C)COC(=O)C |
SMILES (Isomeric) | C/C(=C\CC[C@]1(C=CC2=C(O1)C3=CC=CC=C3OC2=O)C)/CC/C=C(\C)/COC(=O)C |
InChI | InChI=1S/C26H30O5/c1-18(9-7-10-19(2)17-29-20(3)27)11-8-15-26(4)16-14-22-24(31-26)21-12-5-6-13-23(21)30-25(22)28/h5-6,10-14,16H,7-9,15,17H2,1-4H3/b18-11+,19-10+/t26-/m0/s1 |
InChI Key | KQUCHSKUSYALBF-KRKLJUQOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H30O5 |
Molecular Weight | 422.50 g/mol |
Exact Mass | 422.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 5.70 |
There are no found synonyms. |
![2D Structure of [(2E,6E)-2,6-dimethyl-9-[(2S)-2-methyl-5-oxopyrano[3,2-c]chromen-2-yl]nona-2,6-dienyl] acetate 2D Structure of [(2E,6E)-2,6-dimethyl-9-[(2S)-2-methyl-5-oxopyrano[3,2-c]chromen-2-yl]nona-2,6-dienyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2e6e-26-dimethyl-9-2s-2-methyl-5-oxopyrano32-cchromen-2-ylnona-26-dienyl-acetate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.98% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.54% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.96% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.11% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.38% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.56% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.38% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.34% | 99.23% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.87% | 95.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.04% | 85.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.58% | 95.50% |
CHEMBL240 | Q12809 | HERG | 82.41% | 89.76% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.89% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.85% | 96.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.27% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ferula communis |
PubChem | 162843243 |
LOTUS | LTS0225815 |
wikiData | Q105144809 |