(2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide
| Internal ID | d19a6944-f276-4dda-9fd1-5b89dc53014d |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H25NO/c1-4-6-7-8-9-10-11-12-14(16)15-13(3)5-2/h9-13H,4-8H2,1-3H3,(H,15,16)/b10-9+,12-11+/t13-/m1/s1 |
| InChI Key | QMIWSRNEYNUYFE-WKOVGYJXSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.35 g/mol |
| Exact Mass | 223.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of (2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide](https://plantaedb.com/storage/docs/compounds/2023/11/2e4e-n-2r-butan-2-yldeca-24-dienamide.jpg "2D Structure of (2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.23% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.29% | 99.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.98% | 89.34% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.46% | 96.47% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.15% | 92.86% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.07% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.00% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.86% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.68% | 100.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.85% | 98.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.91% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.64% | 96.95% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.63% | 95.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.43% | 94.33% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.04% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.99% | 96.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.98% | 89.63% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.34% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.10% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia dracunculus |
| Piper nigrum |
| Piper pedicellosum |
| Piper retrofractum |
| Piper sarmentosum |
| Piper swartzianum |
| Stauranthus perforatus |
| PubChem | 154497067 |
| LOTUS | LTS0052769 |
| wikiData | Q105224004 |