(2E,4E)-N-[(2R)-2-methylbutyl]dodeca-2,4-dienamide
| Internal ID | 1cd648f8-b95b-43e6-b46e-59fc2a665273 |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | (2E,4E)-N-[(2R)-2-methylbutyl]dodeca-2,4-dienamide |
| SMILES (Canonical) | CCCCCCCC=CC=CC(=O)NCC(C)CC |
| SMILES (Isomeric) | CCCCCCC/C=C/C=C/C(=O)NC[C@H](C)CC |
| InChI | InChI=1S/C17H31NO/c1-4-6-7-8-9-10-11-12-13-14-17(19)18-15-16(3)5-2/h11-14,16H,4-10,15H2,1-3H3,(H,18,19)/b12-11+,14-13+/t16-/m1/s1 |
| InChI Key | OFOZQDMSBJOEHH-XGDVQJBJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.240564612 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of (2E,4E)-N-[(2R)-2-methylbutyl]dodeca-2,4-dienamide](https://plantaedb.com/storage/docs/compounds/2023/11/2e4e-n-2r-2-methylbutyldodeca-24-dienamide.jpg "2D Structure of (2E,4E)-N-[(2R)-2-methylbutyl]dodeca-2,4-dienamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.72% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.45% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.09% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.17% | 92.86% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.79% | 89.34% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.09% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.71% | 96.47% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.69% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.22% | 93.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.01% | 95.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.93% | 96.95% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.81% | 87.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.64% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.29% | 94.45% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.94% | 85.94% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.74% | 92.08% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.37% | 94.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.81% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.69% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.48% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.10% | 94.73% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.16% | 97.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.46% | 97.21% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.24% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Echinacea angustifolia |
| PubChem | 163191162 |
| LOTUS | LTS0176566 |
| wikiData | Q105191330 |