(2E,4E)-N-(2-methylbutyl)deca-2,4-dienamide
| Internal ID | 5ef554c5-d303-400d-99f5-02723ffbbf74 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E)-N-(2-methylbutyl)deca-2,4-dienamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H27NO/c1-4-6-7-8-9-10-11-12-15(17)16-13-14(3)5-2/h9-12,14H,4-8,13H2,1-3H3,(H,16,17)/b10-9+,12-11+ |
| InChI Key | DNFXVYXFGYXVTF-HULFFUFUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.38 g/mol |
| Exact Mass | 237.209264485 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.80 |
| SCHEMBL1031346 |
| SCHEMBL2428781 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.71% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.22% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.20% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.25% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.98% | 89.34% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.93% | 92.86% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.69% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.48% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.22% | 93.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.20% | 90.17% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.70% | 95.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.93% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.76% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.64% | 90.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.37% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.69% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.01% | 100.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.69% | 87.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.96% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.29% | 91.11% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.46% | 97.21% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.43% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper sarmentosum |
| PubChem | 24011649 |
| LOTUS | LTS0077233 |
| wikiData | Q104985539 |