(2E,4E)-1-piperidin-1-ylundeca-2,4-dien-8,10-diyn-1-one
Internal ID | 832feb5f-e0ea-4d6e-871b-232bc7c86125 |
Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
IUPAC Name | (2E,4E)-1-piperidin-1-ylundeca-2,4-dien-8,10-diyn-1-one |
SMILES (Canonical) | C#CC#CCCC=CC=CC(=O)N1CCCCC1 |
SMILES (Isomeric) | C#CC#CCC/C=C/C=C/C(=O)N1CCCCC1 |
InChI | InChI=1S/C16H19NO/c1-2-3-4-5-6-7-8-10-13-16(18)17-14-11-9-12-15-17/h1,7-8,10,13H,5-6,9,11-12,14-15H2/b8-7+,13-10+ |
InChI Key | JGKXLHHRMGZICC-AWGJLQHSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H19NO |
Molecular Weight | 241.33 g/mol |
Exact Mass | 241.146664230 g/mol |
Topological Polar Surface Area (TPSA) | 20.30 Ų |
XlogP | 2.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.83% | 89.63% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 93.18% | 83.57% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.17% | 96.09% |
CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 90.29% | 93.90% |
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 88.25% | 97.34% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.75% | 90.17% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.92% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.72% | 85.14% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.38% | 97.47% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.10% | 90.24% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.96% | 96.25% |
CHEMBL3650 | P11362 | Fibroblast growth factor receptor 1 | 80.03% | 98.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea falcata |
Achillea millefolium |
Artemisia dracunculus |
PubChem | 101589680 |
LOTUS | LTS0074254 |
wikiData | Q105127489 |