8-[4,5-Dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
Internal ID | 5b8b08a4-12b0-4259-a28c-6c8882ac2bc2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 8-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
InChI | InChI=1S/C27H30O15/c28-7-15-20(35)22(37)26(42-27-23(38)21(36)19(34)16(8-29)41-27)25(40-15)18-12(32)5-11(31)17-13(33)6-14(39-24(17)18)9-1-3-10(30)4-2-9/h1-6,15-16,19-23,25-32,34-38H,7-8H2 |
InChI Key | FYTOTHFWELWOCG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | -1.40 |
AKOS040739490 |
8-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.59% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.68% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.70% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.36% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.80% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.62% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.38% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.33% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.75% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.77% | 96.21% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.42% | 83.57% |
CHEMBL3194 | P02766 | Transthyretin | 84.83% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.44% | 99.17% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 83.39% | 98.35% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.65% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.25% | 91.71% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.24% | 89.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.34% | 94.45% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.09% | 91.38% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.86% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adonis aleppica |
Beta vulgaris |
Cycas circinalis |
Glinus lotoides |
Podocarpus nivalis |
Trollius ledebourii |
Vepris heterophylla |
PubChem | 14427440 |
LOTUS | LTS0114327 |
wikiData | Q105004723 |