(2S,3R,4S,5R,6S)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 80ab7137-d644-465b-8f06-97def002270d |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2S,3R,4S,5R,6S)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)OC5C(C(C(C(O5)CO)O)O)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)O[C@H]5[C@@H]([C@H]([C@H]([C@@H](O5)CO)O)O)O)OC |
InChI | InChI=1S/C28H36O13/c1-34-16-5-12(6-17(35-2)21(16)30)25-14-10-39-26(15(14)11-38-25)13-7-18(36-3)27(19(8-13)37-4)41-28-24(33)23(32)22(31)20(9-29)40-28/h5-8,14-15,20,22-26,28-33H,9-11H2,1-4H3/t14-,15-,20-,22-,23-,24+,25+,26+,28-/m0/s1 |
InChI Key | WEKCEGQSIIQPAQ-YHEBDKKWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O13 |
Molecular Weight | 580.60 g/mol |
Exact Mass | 580.21559120 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.64% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.99% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.93% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.80% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 88.32% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.14% | 96.61% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.02% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.67% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.61% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.94% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.76% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.02% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.87% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.53% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 161481407 |
LOTUS | LTS0268220 |
wikiData | Q105303117 |