14,15-Dimethoxy-20-methyl-5,7-dioxa-20-azapentacyclo[11.4.3.01,13.02,10.04,8]icosa-2,4(8),9,14-tetraene-16,19-dione
| Internal ID | d8b73a48-7add-4553-9b45-a4c3268a8692 |
| Taxonomy | Alkaloids and derivatives > Hasubanan alkaloids |
| IUPAC Name | 14,15-dimethoxy-20-methyl-5,7-dioxa-20-azapentacyclo[11.4.3.01,13.02,10.04,8]icosa-2,4(8),9,14-tetraene-16,19-dione |
| SMILES (Canonical) | CN1C(=O)CC23C1(CCC4=CC5=C(C=C42)OCO5)C(=C(C(=O)C3)OC)OC |
| SMILES (Isomeric) | CN1C(=O)CC23C1(CCC4=CC5=C(C=C42)OCO5)C(=C(C(=O)C3)OC)OC |
| InChI | InChI=1S/C20H21NO6/c1-21-16(23)9-19-8-13(22)17(24-2)18(25-3)20(19,21)5-4-11-6-14-15(7-12(11)19)27-10-26-14/h6-7H,4-5,8-10H2,1-3H3 |
| InChI Key | OSLGNVYVYHUNJQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13688739 g/mol |
| Topological Polar Surface Area (TPSA) | 74.30 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
![2D Structure of 14,15-Dimethoxy-20-methyl-5,7-dioxa-20-azapentacyclo[11.4.3.01,13.02,10.04,8]icosa-2,4(8),9,14-tetraene-16,19-dione](https://plantaedb.com/storage/docs/compounds/2023/11/2dd05f20-8735-11ee-b141-5d733db87191.jpg "2D Structure of 14,15-Dimethoxy-20-methyl-5,7-dioxa-20-azapentacyclo[11.4.3.01,13.02,10.04,8]icosa-2,4(8),9,14-tetraene-16,19-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.78% | 96.77% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.56% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.36% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.30% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.75% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.36% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.24% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.88% | 93.99% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.71% | 82.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.08% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.29% | 92.62% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.87% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.33% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.57% | 85.14% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.33% | 97.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.24% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stephania delavayi |
| PubChem | 21769995 |
| LOTUS | LTS0141845 |
| wikiData | Q105199058 |