(1S,12S,15R,18S,19S,20S)-18-hydroxy-19-methoxycarbonyl-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-12-carboxylic acid
Internal ID | 3c13df22-2485-447c-8e4f-b90d16af3f62 |
Taxonomy | Alkaloids and derivatives > Yohimbine alkaloids |
IUPAC Name | (1S,12S,15R,18S,19S,20S)-18-hydroxy-19-methoxycarbonyl-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-12-carboxylic acid |
SMILES (Canonical) | COC(=O)C1C(CCC2C1CC3C4=C(CC(N3C2)C(=O)O)C5=CC=CC=C5N4)O |
SMILES (Isomeric) | COC(=O)[C@@H]1[C@H](CC[C@@H]2[C@@H]1C[C@H]3C4=C(C[C@H](N3C2)C(=O)O)C5=CC=CC=C5N4)O |
InChI | InChI=1S/C22H26N2O5/c1-29-22(28)19-13-8-16-20-14(12-4-2-3-5-15(12)23-20)9-17(21(26)27)24(16)10-11(13)6-7-18(19)25/h2-5,11,13,16-19,23,25H,6-10H2,1H3,(H,26,27)/t11-,13-,16-,17-,18-,19-/m0/s1 |
InChI Key | FKDCWOOHMIPXRV-AMTPKYOQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H26N2O5 |
Molecular Weight | 398.50 g/mol |
Exact Mass | 398.18417193 g/mol |
Topological Polar Surface Area (TPSA) | 103.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.25% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.16% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.04% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 95.89% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.34% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.03% | 94.45% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 90.53% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.92% | 97.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.00% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 84.19% | 97.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.06% | 94.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.89% | 89.00% |
CHEMBL228 | P31645 | Serotonin transporter | 81.78% | 95.51% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.38% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adina eurhyncha |
Gardenia sootepensis |
Gardenia tubifera |
PubChem | 163188031 |
LOTUS | LTS0063949 |
wikiData | Q104400792 |