(2R,3R,4S,5S,6R)-2-[[(2R,3S,4R,5R,6S)-6-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18R)-6-hydroxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-4,5-dihydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol
| Internal ID | 2251705e-3f08-4dc6-858a-14f3d84ed30f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4R,5R,6S)-6-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18R)-6-hydroxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-4,5-dihydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)COC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)C)O)O)O)O[C@H]9[C@@H]([C@H]([C@H]([C@H](O9)CO)O)O)O)O)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
| InChI | InChI=1S/C57H96O28/c1-21(19-75-51-44(70)39(65)36(62)30(16-58)79-51)8-13-57(74)22(2)34-29(85-57)15-28-26-7-6-24-14-25(9-11-55(24,4)27(26)10-12-56(28,34)5)78-52-46(72)41(67)48(32(18-60)81-52)83-54-47(73)42(68)49(84-53-45(71)40(66)37(63)31(17-59)80-53)33(82-54)20-76-50-43(69)38(64)35(61)23(3)77-50/h21-54,58-74H,6-20H2,1-5H3/t21-,22-,23+,24+,25-,26+,27-,28-,29-,30+,31+,32+,33+,34-,35+,36+,37-,38-,39-,40-,41+,42+,43+,44+,45+,46+,47+,48+,49+,50+,51+,52+,53-,54-,55-,56-,57+/m0/s1 |
| InChI Key | FPJGYWRVZSOVDV-QQXCDQKGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C57H96O28 |
| Molecular Weight | 1229.40 g/mol |
| Exact Mass | 1228.60881240 g/mol |
| Topological Polar Surface Area (TPSA) | 445.00 Ų |
| XlogP | -3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.90% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.18% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.69% | 95.93% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.98% | 92.86% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.28% | 96.61% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.79% | 89.05% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.53% | 98.05% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.28% | 98.10% |
| CHEMBL233 | P35372 | Mu opioid receptor | 91.63% | 97.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.24% | 97.25% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.02% | 93.18% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.71% | 96.21% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.62% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.45% | 97.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.64% | 94.45% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.55% | 95.36% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.75% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 88.55% | 98.46% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.90% | 97.79% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.36% | 89.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.21% | 95.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.89% | 96.47% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.64% | 92.98% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.62% | 97.86% |
| CHEMBL204 | P00734 | Thrombin | 85.51% | 96.01% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.34% | 92.32% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.26% | 97.31% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.44% | 96.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.18% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.17% | 93.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.82% | 100.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 83.72% | 94.45% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 83.67% | 87.38% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.90% | 97.50% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.43% | 97.64% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.28% | 100.00% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.08% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.07% | 92.50% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.51% | 97.56% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.27% | 92.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.26% | 92.94% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.75% | 91.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 80.59% | 98.35% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.58% | 96.77% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.39% | 96.90% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.31% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asparagus filicinus |
| PubChem | 163015892 |
| LOTUS | LTS0179648 |
| wikiData | Q104999231 |