[2-[6-(Acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-2-(hydroxymethyl)oxolan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 7b9ac5f0-e887-40dd-8a3a-8f52d4605a59 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [2-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-2-(hydroxymethyl)oxolan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)OC)O)OC(=O)C=CC4=CC=C(C=C4)O)CO)O)O)O |
SMILES (Isomeric) | CC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)OC)O)OC(=O)C=CC4=CC=C(C=C4)O)CO)O)O)O |
InChI | InChI=1S/C33H38O17/c1-17(35)45-14-23-27(40)29(42)30(43)32(47-23)50-33(16-34)31(48-26(39)12-6-18-3-8-20(36)9-4-18)28(41)24(49-33)15-46-25(38)11-7-19-5-10-21(37)22(13-19)44-2/h3-13,23-24,27-32,34,36-37,40-43H,14-16H2,1-2H3 |
InChI Key | WORYROBPYQCALN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H38O17 |
Molecular Weight | 706.60 g/mol |
Exact Mass | 706.21089974 g/mol |
Topological Polar Surface Area (TPSA) | 257.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.06% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.76% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.07% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.21% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.00% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.35% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.89% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.35% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 91.34% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.66% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.02% | 89.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.56% | 95.50% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.74% | 91.49% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.49% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.46% | 97.21% |
CHEMBL2535 | P11166 | Glucose transporter | 83.49% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.11% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.90% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.80% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.44% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.83% | 96.95% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.04% | 89.67% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.23% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Canna indica |
PubChem | 73803972 |
LOTUS | LTS0197822 |
wikiData | Q105309660 |