[6-[5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-5-hydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | d6de2877-6ddc-4941-b6e9-321b7ce0c21a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-5-hydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C=CC6=CC=C(C=C6)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C=CC6=CC=C(C=C6)O |
InChI | InChI=1S/C39H32O14/c1-20-35(51-30(45)16-6-21-2-10-24(40)11-3-21)38(52-31(46)17-7-22-4-12-25(41)13-5-22)34(48)39(49-20)53-37-33(47)32-28(44)18-27(43)19-29(32)50-36(37)23-8-14-26(42)15-9-23/h2-20,34-35,38-44,48H,1H3 |
InChI Key | RMHWAEFAOBGGBH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H32O14 |
Molecular Weight | 724.70 g/mol |
Exact Mass | 724.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 5.80 |
There are no found synonyms. |
![2D Structure of [6-[5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-5-hydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [6-[5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-5-hydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-2-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/296ddfb0-8704-11ee-8ec6-e18322e0679b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.05% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.36% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.06% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.39% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.72% | 95.64% |
CHEMBL3194 | P02766 | Transthyretin | 95.53% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.38% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.37% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.16% | 99.17% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.98% | 98.35% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.08% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.92% | 96.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.66% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.26% | 99.23% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.72% | 93.99% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.22% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.00% | 95.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.99% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.96% | 90.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.62% | 96.12% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.51% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.94% | 90.71% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.78% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epimedium sagittatum |
Eriobotrya japonica |
Hornstedtia reticulata |
Laurus nobilis |
PubChem | 156602915 |
LOTUS | LTS0047059 |
wikiData | Q105240786 |