methyl 2-[(1R,2R,5R,6R,13S,14R,16R)-6-(furan-3-yl)-14-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate
Internal ID | a8b8a0e7-0b66-46cc-8762-86f5e7f86d4f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | methyl 2-[(1R,2R,5R,6R,13S,14R,16R)-6-(furan-3-yl)-14-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate |
SMILES (Canonical) | CC1(C(C2(C3CCC4(C(OC(=O)CC4=C3CC(C1O)C2=O)C5=COC=C5)C)C)CC(=O)OC)C |
SMILES (Isomeric) | C[C@@]12CC[C@@H]3C(=C1CC(=O)O[C@H]2C4=COC=C4)C[C@H]5[C@H](C([C@H]([C@@]3(C5=O)C)CC(=O)OC)(C)C)O |
InChI | InChI=1S/C27H34O7/c1-25(2)19(12-20(28)32-5)27(4)17-6-8-26(3)18(15(17)10-16(22(25)30)23(27)31)11-21(29)34-24(26)14-7-9-33-13-14/h7,9,13,16-17,19,22,24,30H,6,8,10-12H2,1-5H3/t16-,17+,19+,22+,24-,26+,27+/m0/s1 |
InChI Key | WAIKPAHSFOBDTD-BCYBAXIQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O7 |
Molecular Weight | 470.60 g/mol |
Exact Mass | 470.23045342 g/mol |
Topological Polar Surface Area (TPSA) | 103.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
![2D Structure of methyl 2-[(1R,2R,5R,6R,13S,14R,16R)-6-(furan-3-yl)-14-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate 2D Structure of methyl 2-[(1R,2R,5R,6R,13S,14R,16R)-6-(furan-3-yl)-14-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2924eb90-82b3-11ee-9f16-276fddf8482f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.15% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.02% | 83.82% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.83% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.33% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.77% | 97.09% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.73% | 94.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.01% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.13% | 86.33% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 86.00% | 98.59% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.54% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.19% | 91.24% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.83% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.53% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.32% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.65% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.47% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.63% | 94.00% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.17% | 91.38% |
CHEMBL5028 | O14672 | ADAM10 | 81.12% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.96% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.85% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Khaya ivorensis |
PubChem | 162913837 |
LOTUS | LTS0077104 |
wikiData | Q105300236 |