(3S,3'R,4S,5R,5'S,10S,13S,14S,17S)-4-(hydroxymethyl)-3',4,10,13,14-pentamethyl-5'-propanoyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[2,3,5,6,7,11,12,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-15-one
Internal ID | f0ecb5f1-9df7-44a2-8216-f38a405ce3e8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3S,3'R,4S,5R,5'S,10S,13S,14S,17S)-4-(hydroxymethyl)-3',4,10,13,14-pentamethyl-5'-propanoyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[2,3,5,6,7,11,12,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-15-one |
SMILES (Canonical) | CCC(=O)C1CC(C2(O1)CC(=O)C3(C2(CCC4=C3CCC5C4(CCC(C5(C)CO)OC6C(C(C(C(O6)CO)O)O)O)C)C)C)C |
SMILES (Isomeric) | CCC(=O)[C@@H]1C[C@H]([C@@]2(O1)CC(=O)[C@@]3([C@@]2(CCC4=C3CC[C@@H]5[C@@]4(CC[C@@H]([C@]5(C)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)C)C |
InChI | InChI=1S/C35H54O10/c1-7-21(38)22-14-18(2)35(45-22)15-25(39)34(6)20-8-9-24-31(3,19(20)10-13-33(34,35)5)12-11-26(32(24,4)17-37)44-30-29(42)28(41)27(40)23(16-36)43-30/h18,22-24,26-30,36-37,40-42H,7-17H2,1-6H3/t18-,22+,23-,24-,26+,27-,28+,29-,30+,31-,32-,33+,34-,35+/m1/s1 |
InChI Key | DSSVQNFXFORKJL-KFIDPHSRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H54O10 |
Molecular Weight | 634.80 g/mol |
Exact Mass | 634.37169792 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.88% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.89% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.44% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.35% | 98.95% |
CHEMBL220 | P22303 | Acetylcholinesterase | 90.14% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.25% | 96.61% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.87% | 95.38% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.00% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.67% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.95% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.70% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.98% | 92.62% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.46% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.33% | 95.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.71% | 82.50% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.32% | 97.05% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.30% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.26% | 86.92% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.96% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.09% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.74% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dipterocarpus grandiflorus |
Hopea parviflora |
Muscari armeniacum |
Vitis vinifera |
PubChem | 163195135 |
LOTUS | LTS0039098 |
wikiData | Q104986779 |