28-Oxoallobetulin
Internal ID | 2947c4a5-ed1b-4b72-9cf8-db24be27a263 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,4R,5R,8R,10S,13R,14R,17R,18R,19R)-10-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one |
SMILES (Canonical) | CC1(CCC23CCC4(C(C2C1OC3=O)CCC5C4(CCC6C5(CCC(C6(C)C)O)C)C)C)C |
SMILES (Isomeric) | C[C@@]12CC[C@@]34CCC([C@@H]([C@@H]3[C@H]1CC[C@H]5[C@]2(CC[C@@H]6[C@@]5(CC[C@@H](C6(C)C)O)C)C)OC4=O)(C)C |
InChI | InChI=1S/C30H48O3/c1-25(2)14-16-30-17-15-28(6)18(22(30)23(25)33-24(30)32)8-9-20-27(5)12-11-21(31)26(3,4)19(27)10-13-29(20,28)7/h18-23,31H,8-17H2,1-7H3/t18-,19+,20-,21+,22+,23-,27+,28-,29-,30+/m1/s1 |
InChI Key | BVJDDPRBYGBPKD-TVZSAIOCSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H48O3 |
Molecular Weight | 456.70 g/mol |
Exact Mass | 456.36034539 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 7.90 |
CHEMBL522595 |
DTXSID901317227 |
24035-70-9 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.56% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.50% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.36% | 96.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.66% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.11% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.78% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.73% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.85% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.53% | 93.04% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.09% | 92.94% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.78% | 85.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.33% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 81.92% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.54% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.53% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.47% | 82.69% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.16% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diospyros lotus |
PubChem | 12305934 |
LOTUS | LTS0207709 |
wikiData | Q104946600 |