(1S,4aS,7R,7aS)-1-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-7-hydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid
Internal ID | 8813046f-b8ba-4c66-948d-0e83069b0aab |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | (1S,4aS,7R,7aS)-1-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-7-hydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC1(CCC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)CO)O)O)OC(=O)C=CC4=CC=CC=C4)O |
SMILES (Isomeric) | C[C@]1(CC[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)OC(=O)/C=C/C4=CC=CC=C4)O |
InChI | InChI=1S/C25H30O11/c1-25(32)10-9-14-15(22(30)31)12-33-23(18(14)25)36-24-21(20(29)19(28)16(11-26)34-24)35-17(27)8-7-13-5-3-2-4-6-13/h2-8,12,14,16,18-21,23-24,26,28-29,32H,9-11H2,1H3,(H,30,31)/b8-7+/t14-,16-,18-,19-,20+,21-,23+,24+,25-/m1/s1 |
InChI Key | BIZBWPKKEHPFMI-UBPMSYCJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O11 |
Molecular Weight | 506.50 g/mol |
Exact Mass | 506.17881177 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.36% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.24% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.03% | 95.56% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 93.69% | 94.23% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.61% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.37% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.02% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.99% | 94.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.36% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.79% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.04% | 90.00% |
CHEMBL5028 | O14672 | ADAM10 | 86.78% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.97% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.37% | 98.95% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.97% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.46% | 96.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.25% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avicennia marina |
PubChem | 162998484 |
LOTUS | LTS0019826 |
wikiData | Q104936900 |