4-Hydroxy-5-methoxy-2,18-dioxa-10-azapentacyclo[20.2.2.19,17.03,8.010,15]heptacosa-1(24),3(8),4,6,22,25-hexaen-19-one
Internal ID | 426165cc-1589-4537-b351-f1dda66c9ed9 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | 4-hydroxy-5-methoxy-2,18-dioxa-10-azapentacyclo[20.2.2.19,17.03,8.010,15]heptacosa-1(24),3(8),4,6,22,25-hexaen-19-one |
SMILES (Canonical) | COC1=C(C2=C(C=C1)C3CC(CC4N3CCCC4)OC(=O)CCC5=CC=C(O2)C=C5)O |
SMILES (Isomeric) | COC1=C(C2=C(C=C1)C3CC(CC4N3CCCC4)OC(=O)CCC5=CC=C(O2)C=C5)O |
InChI | InChI=1S/C25H29NO5/c1-29-22-11-10-20-21-15-19(14-17-4-2-3-13-26(17)21)30-23(27)12-7-16-5-8-18(9-6-16)31-25(20)24(22)28/h5-6,8-11,17,19,21,28H,2-4,7,12-15H2,1H3 |
InChI Key | OBHAUUFTXJOWIW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H29NO5 |
Molecular Weight | 423.50 g/mol |
Exact Mass | 423.20457303 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of 4-Hydroxy-5-methoxy-2,18-dioxa-10-azapentacyclo[20.2.2.19,17.03,8.010,15]heptacosa-1(24),3(8),4,6,22,25-hexaen-19-one 2D Structure of 4-Hydroxy-5-methoxy-2,18-dioxa-10-azapentacyclo[20.2.2.19,17.03,8.010,15]heptacosa-1(24),3(8),4,6,22,25-hexaen-19-one](https://plantaedb.com/storage/docs/compounds/2023/11/272ba740-8540-11ee-8c92-9f52aeaa9567.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.23% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.96% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.52% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 93.28% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.05% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.76% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.82% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.58% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.30% | 93.03% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.98% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.68% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.46% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.46% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.77% | 89.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.12% | 92.94% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.00% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lagerstroemia indica |
PubChem | 163006093 |
LOTUS | LTS0074786 |
wikiData | Q105189002 |