2,7-Dimethoxy-1,3,6,8-tetrahydroxyxanthone
| Internal ID | 585692b9-06b5-46e4-9ffd-47519016d914 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,3,6,8-tetrahydroxy-2,7-dimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1O)OC3=C(C2=O)C(=C(C(=C3)O)OC)O)O |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1O)OC3=C(C2=O)C(=C(C(=C3)O)OC)O)O |
| InChI | InChI=1S/C15H12O8/c1-21-14-5(16)3-7-9(12(14)19)11(18)10-8(23-7)4-6(17)15(22-2)13(10)20/h3-4,16-17,19-20H,1-2H3 |
| InChI Key | LYCMTRLSGDVTRF-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C15H12O8 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.05321734 g/mol |
| Topological Polar Surface Area (TPSA) | 126.00 Ų |
| XlogP | 2.00 |
| 1,3,6,8-tetrahydroxy-2,7-dimethoxyxanthone |
| 1,3,6,8-tetrahydroxy-2,7-dimethoxyxanthen-9-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.05% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.88% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.49% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.46% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.36% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.31% | 94.45% |
| CHEMBL3194 | P02766 | Transthyretin | 83.22% | 90.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.19% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.38% | 94.73% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.35% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.09% | 99.15% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.39% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.07% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eriocaulon buergerianum |
| Polygala cyparissias |
| PubChem | 15380735 |
| LOTUS | LTS0049364 |
| wikiData | Q105159224 |