(2,7-Dihydroxy-4-methoxy-9,10-dihydrophenanthren-1-yl)-(4-hydroxyphenyl)methanone
| Internal ID | 64b66f9a-258b-472c-9a2a-492ce0921905 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | (2,7-dihydroxy-4-methoxy-9,10-dihydrophenanthren-1-yl)-(4-hydroxyphenyl)methanone |
| SMILES (Canonical) | COC1=C2C(=C(C(=C1)O)C(=O)C3=CC=C(C=C3)O)CCC4=C2C=CC(=C4)O |
| SMILES (Isomeric) | COC1=C2C(=C(C(=C1)O)C(=O)C3=CC=C(C=C3)O)CCC4=C2C=CC(=C4)O |
| InChI | InChI=1S/C22H18O5/c1-27-19-11-18(25)21(22(26)12-2-5-14(23)6-3-12)17-8-4-13-10-15(24)7-9-16(13)20(17)19/h2-3,5-7,9-11,23-25H,4,8H2,1H3 |
| InChI Key | JJDDGXAZWOHMGF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.41% | 98.35% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.29% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.64% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.87% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.63% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.56% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 92.10% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.73% | 98.95% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.09% | 91.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.97% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.30% | 90.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.84% | 91.19% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.52% | 95.89% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.47% | 91.79% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.85% | 91.49% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.08% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.94% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.86% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.63% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla striata |
| PubChem | 129686646 |
| LOTUS | LTS0099189 |
| wikiData | Q105129568 |