2,7-Dihydrohomoerysotrine
| Internal ID | 7c91639a-e5fc-4096-a4c5-297417ba5af3 |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Homoerythrinane alkaloids |
| IUPAC Name | (1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene |
| SMILES (Canonical) | COC1CC=C2CCN3C2(C1)C4=CC(=C(C=C4CCC3)OC)OC |
| SMILES (Isomeric) | CO[C@H]1CC=C2CCN3[C@]2(C1)C4=CC(=C(C=C4CCC3)OC)OC |
| InChI | InChI=1S/C20H27NO3/c1-22-16-7-6-15-8-10-21-9-4-5-14-11-18(23-2)19(24-3)12-17(14)20(15,21)13-16/h6,11-12,16H,4-5,7-10,13H2,1-3H3/t16-,20-/m0/s1 |
| InChI Key | VFNBFPRWBICVGZ-JXFKEZNVSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 30.90 Ų |
| XlogP | 2.70 |
| 51095-85-3 |
| (1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene |
| Homoerysotrine,2,7-dihydro- |
| NSC 166069 |
| CHEMBL487209 |
| DTXSID60304511 |
| HY-N1681 |
| NSC166069 |
| AKOS032948726 |
| FS-9944 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.62% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.07% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.44% | 92.94% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.05% | 93.40% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 92.74% | 95.12% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.42% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.41% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.29% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.59% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.53% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.97% | 86.33% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.29% | 91.03% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.92% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.91% | 91.11% |
| CHEMBL6031 | Q9H9B1 | Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 | 83.57% | 94.33% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 83.09% | 92.38% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.00% | 90.24% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.08% | 99.18% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.88% | 97.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.48% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.03% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Manoao colensoi |
| PubChem | 296195 |
| LOTUS | LTS0081059 |
| wikiData | Q72465106 |