(2R)-4-[(2S,11S)-2,11-dihydroxy-11-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]oxolan-2-yl]undecyl]-2-methyl-2H-furan-5-one
Internal ID | c62fd0a0-512d-4a7c-a75e-7c610f5a6bee |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2R)-4-[(2S,11S)-2,11-dihydroxy-11-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]oxolan-2-yl]undecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCC(C1CCC(O1)C2CCC(O2)C(CCCCCCCCC(CC3=CC(OC3=O)C)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC[C@H]([C@H]1CC[C@@H](O1)[C@H]2CC[C@@H](O2)[C@H](CCCCCCCC[C@@H](CC3=C[C@H](OC3=O)C)O)O)O |
InChI | InChI=1S/C37H66O7/c1-3-4-5-6-7-8-9-10-14-17-20-31(39)33-22-24-35(43-33)36-25-23-34(44-36)32(40)21-18-15-12-11-13-16-19-30(38)27-29-26-28(2)42-37(29)41/h26,28,30-36,38-40H,3-25,27H2,1-2H3/t28-,30+,31-,32+,33-,34-,35-,36-/m1/s1 |
InChI Key | GXZZLWVQYXFTJE-RZQMBMPISA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H66O7 |
Molecular Weight | 622.90 g/mol |
Exact Mass | 622.48085444 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 9.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.75% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.70% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.09% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.96% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.90% | 99.17% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.45% | 85.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.27% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.37% | 95.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.30% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.48% | 97.09% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.77% | 92.88% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.26% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.23% | 92.08% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.12% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.51% | 86.33% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.78% | 91.81% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.52% | 99.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.08% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
PubChem | 162970797 |
LOTUS | LTS0196507 |
wikiData | Q105322337 |