2,6-Dimethyl-10-methylidenedodeca-2,6,11-trienal
Internal ID | 872095bb-43de-4465-81d2-34d3b189aef9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal |
SMILES (Canonical) | CC(=CCCC(=C)C=C)CCC=C(C)C=O |
SMILES (Isomeric) | CC(=CCCC(=C)C=C)CCC=C(C)C=O |
InChI | InChI=1S/C15H22O/c1-5-13(2)8-6-9-14(3)10-7-11-15(4)12-16/h5,9,11-12H,1-2,6-8,10H2,3-4H3 |
InChI Key | NOPLRNXKHZRXHT-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H22O |
Molecular Weight | 218.33 g/mol |
Exact Mass | 218.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 4.80 |
8028-48-6 |
DTXSID0069383 |
FT-0622938 |
FT-0623979 |
8008-57-9 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.33% | 96.09% |
CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 86.55% | 82.05% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 84.15% | 95.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.02% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 83.34% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.30% | 91.11% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.31% | 89.34% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.01% | 83.82% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.39% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astrantia major |
PubChem | 62161 |
LOTUS | LTS0179788 |
wikiData | Q81996249 |