2',6'-Dihydroxy-4,4'-dimethoxydihydrochalcone
| Internal ID | 1a2b6720-0c48-4c1d-ac22-6e0ab3415434 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
| IUPAC Name | 1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2O)OC)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2O)OC)O |
| InChI | InChI=1S/C17H18O5/c1-21-12-6-3-11(4-7-12)5-8-14(18)17-15(19)9-13(22-2)10-16(17)20/h3-4,6-7,9-10,19-20H,5,8H2,1-2H3 |
| InChI Key | VVDZZNWYISOIDK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.30 |
| 2',6'-Dihydroxy-4,4'-dimethoxydihydrochalcone |
| Calomelanone |
| 1-(2,6-Dihydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
| EINECS 252-458-8 |
| 2',6'-Dihydroxy 4',4-dimethoxydihydrochalcone |
| SCHEMBL5084404 |
| CHEMBL3264622 |
| DTXSID00956679 |
| 1-Propanone, 1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)- |
| LMPK12120546 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.02% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.86% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.11% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.76% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.69% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.24% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.19% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.67% | 96.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.09% | 99.15% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.61% | 95.50% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.39% | 90.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.11% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Greyia flanaganii |
| Pityrogramma calomelanos |
| Pityrogramma ebenea |
| Sarcandra glabra |
| PubChem | 3084606 |
| LOTUS | LTS0192650 |
| wikiData | Q105248585 |