2,6-Bis[(4-hydroxyphenyl)methyl]-3-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol
| Internal ID | 05eb3681-37c2-430b-908c-867ea2d12ad4 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | 2,6-bis[(4-hydroxyphenyl)methyl]-3-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol |
| SMILES (Canonical) | COC1=CC=CC(=C1)CCC2=CC(=C(C(=C2CC3=CC=C(C=C3)O)O)CC4=CC=C(C=C4)O)OC |
| SMILES (Isomeric) | COC1=CC=CC(=C1)CCC2=CC(=C(C(=C2CC3=CC=C(C=C3)O)O)CC4=CC=C(C=C4)O)OC |
| InChI | InChI=1S/C30H30O5/c1-34-26-5-3-4-20(16-26)6-11-23-19-29(35-2)28(18-22-9-14-25(32)15-10-22)30(33)27(23)17-21-7-12-24(31)13-8-21/h3-5,7-10,12-16,19,31-33H,6,11,17-18H2,1-2H3 |
| InChI Key | LRSSYIWAUGXOKG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 6.90 |
| There are no found synonyms. |
![2D Structure of 2,6-Bis[(4-hydroxyphenyl)methyl]-3-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/26-bis4-hydroxyphenylmethyl-3-methoxy-5-2-3-methoxyphenylethylphenol.jpg "2D Structure of 2,6-Bis[(4-hydroxyphenyl)methyl]-3-methoxy-5-[2-(3-methoxyphenyl)ethyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.30% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.00% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.36% | 95.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.06% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.80% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.08% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.87% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.66% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.62% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.41% | 90.20% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 88.96% | 95.39% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.67% | 95.89% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 88.53% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.15% | 99.15% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.12% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.41% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.18% | 94.73% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.28% | 99.18% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.05% | 86.92% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.04% | 90.00% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 82.03% | 92.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.72% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla striata |
| PubChem | 141467282 |
| LOTUS | LTS0180139 |
| wikiData | Q105156305 |